Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 4,6,8-Trimethoxyfuro[2,3-b]quinoline |
|---|---|
| Synonyms | C10716; Furo(2,3-B)Quinoline, 4,6,8-Trimethoxy-; Maculosidine |
| Molecular Structure | ![CAS#: 522-19-0, 4,6,8-Trimethoxyfuro[2,3-b]quinoline](/moreStructures/522-19-0.gif) |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 |
| CAS Registry Number | 522-19-0 |
| SMILES | C2=C(C1=NC3=C(C(=C1C=C2OC)OC)C=CO3)OC |
| InChI | 1S/C14H13NO4/c1-16-8-6-10-12(11(7-8)17-2)15-14-9(4-5-19-14)13(10)18-3/h4-7H,1-3H3 |
| InChIKey | SHAVHFJCSQWTFF-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.024°C at 760 mmHg (Cal.) |
| Flash point | 208.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6,8-Trimethoxyfuro[2,3-b]quinoline |