| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Hexamethylene Tetramine Thiocyanate |
|---|---|
| Synonyms | Thiocyanic Acid, Compound With 1,3,5,7-Tetraazatricyclo(3.3.1.13,7)Decane |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.27 |
| CAS Registry Number | 52302-51-9 |
| EINECS | 257-829-8 |
| SMILES | [NH+]13CN2CN(C1)CN(C2)C3.C(#N)[S-] |
| InChI | 1S/C6H12N4.CHNS/c1-7-2-9-4-8(1)5-10(3-7)6-9;2-1-3/h1-6H2;3H |
| InChIKey | KVQREULTCKEKCG-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Hexamethylene Tetramine Thiocyanate |