| Sequoia Research Products Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| Name | (±)-Vestitol |
|---|---|
| Synonyms | 3-(2-Hydroxy-4-Methoxy-Phenyl)Chroman-7-Ol; 3-(2-Hydroxy-4-Methoxyphenyl)-7-Chromanol; Acon1_000883 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 52305-03-0 (56701-24-7) |
| SMILES | C3=C(C2CC1=C(C=C(O)C=C1)OC2)C(=CC(=C3)OC)O |
| InChI | 1S/C16H16O4/c1-19-13-4-5-14(15(18)8-13)11-6-10-2-3-12(17)7-16(10)20-9-11/h2-5,7-8,11,17-18H,6,9H2,1H3 |
| InChIKey | XRVFNNUXNVWYTI-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.544°C at 760 mmHg (Cal.) |
| Flash point | 206.928°C (Cal.) |
| (1) | Cornia Mara, Merlini Lucio. A possible chemical analogy for pterocarpan biosynthesis, Journal of the Chemical Society, Chemical Communications, 1975 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (±)-Vestitol |