|
CAS#: 52335-18-9 Product: Ethyl (5-Methyl-1H-Benzimidazol-2-Yl)Acetate No suppilers available for the product. |
| Name | Ethyl (5-Methyl-1H-Benzimidazol-2-Yl)Acetate |
|---|---|
| Synonyms | 2-(6-Methyl-1H-Benzimidazol-2-Yl)Acetic Acid Ethyl Ester; Ethyl 2-(6-Methyl-1H-Benzimidazol-2-Yl)Ethanoate; Nsc190675 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 52335-18-9 |
| SMILES | C2=C1N=C(CC(OCC)=O)[NH]C1=CC(=C2)C |
| InChI | 1S/C12H14N2O2/c1-3-16-12(15)7-11-13-9-5-4-8(2)6-10(9)14-11/h4-6H,3,7H2,1-2H3,(H,13,14) |
| InChIKey | KSIHSZGRNBFCOR-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.002°C at 760 mmHg (Cal.) |
| Flash point | 208.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (5-Methyl-1H-Benzimidazol-2-Yl)Acetate |