|
CAS#: 52357-17-2 Product: 1-Propyl-3,5-Diethyl-6-Chlorouracil No suppilers available for the product. |
| Name | 1-Propyl-3,5-Diethyl-6-Chlorouracil |
|---|---|
| Synonyms | 6-Chloro-3,5-Diethyl-1-Propyl-Pyrimidine-2,4-Dione; 6-Chloro-3,5-Diethyl-1-Propyl-Pyrimidine-2,4-Quinone; 1-Propyl-3,5-Diethyl-6-Chlorouracil |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 |
| CAS Registry Number | 52357-17-2 |
| SMILES | C(C)CN1C(=C(CC)C(=O)N(CC)C1=O)Cl |
| InChI | 1S/C11H17ClN2O2/c1-4-7-14-9(12)8(5-2)10(15)13(6-3)11(14)16/h4-7H2,1-3H3 |
| InChIKey | DYVLWMXLCDYPKG-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.149°C at 760 mmHg (Cal.) |
| Flash point | 140.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Propyl-3,5-Diethyl-6-Chlorouracil |