|
CAS#: 52389-27-2 Product: Dexclamol Hydrochloride No suppilers available for the product. |
| Name | Dexclamol Hydrochloride |
|---|---|
| Synonyms | Dexclamol Hydrochloride (Usan); Ay-24169; ( )-Dexclamol-Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C24H30ClNO |
| Molecular Weight | 383.96 |
| CAS Registry Number | 52389-27-2 |
| SMILES | [C@@H]14N(CC[C@@](O)(C1)C(C)C)C[C@H]2C5=C(CCC3=CC=CC=C23)C=CC=C45.[H+].[Cl-] |
| InChI | 1S/C24H29NO.ClH/c1-16(2)24(26)12-13-25-15-21-19-8-4-3-6-17(19)10-11-18-7-5-9-20(23(18)21)22(25)14-24;/h3-9,16,21-22,26H,10-15H2,1-2H3;1H/t21-,22-,24-;/m1./s1 |
| InChIKey | LSZSZUUPKKTESX-GOXMAUIJSA-N |
| Boiling point | 494.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 242.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dexclamol Hydrochloride |