|
CAS#: 524738-95-2 Product: 4,5-Dimethyl-1H,1'H-2,2'-Biimidazole No suppilers available for the product. |
| Name | 4,5-Dimethyl-1H,1'H-2,2'-Biimidazole |
|---|---|
| Synonyms | 2,2-Bi-1H-imidazole, 4,5-dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 524738-95-2 |
| SMILES | Cc1c(nc([nH]1)c2[nH]ccn2)C |
| InChI | 1S/C8H10N4/c1-5-6(2)12-8(11-5)7-9-3-4-10-7/h3-4H,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | FHCQHEKPGQIWHO-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.128°C at 760 mmHg (Cal.) |
| Flash point | 227.438°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethyl-1H,1'H-2,2'-Biimidazole |