|
CAS#: 525-14-4 Product: 8-Hydroxy-9-oxo-9H-xanthen-2-yl beta-D-glucopyranosiduronic acid No suppilers available for the product. |
| Name | 8-Hydroxy-9-oxo-9H-xanthen-2-yl beta-D-glucopyranosiduronic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O10 |
| Molecular Weight | 404.32 |
| CAS Registry Number | 525-14-4 |
| SMILES | OC(=O)[C@H]4O[C@@H](Oc1ccc2Oc3cccc(O)c3C(=O)c2c1)[C@H](O)[C@@H](O)[C@@H]4O |
| InChI | 1S/C19H16O10/c20-9-2-1-3-11-12(9)13(21)8-6-7(4-5-10(8)28-11)27-19-16(24)14(22)15(23)17(29-19)18(25)26/h1-6,14-17,19-20,22-24H,(H,25,26)/t14-,15-,16+,17-,19+/m0/s1 |
| InChIKey | JGIDSJGZGFYYNX-YUAHOQAQSA-N |
| Density | 1.737g/cm3 (Cal.) |
|---|---|
| Boiling point | 780.912°C at 760 mmHg (Cal.) |
| Flash point | 284.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Hydroxy-9-oxo-9H-xanthen-2-yl beta-D-glucopyranosiduronic acid |