|
CAS#: 52509-83-8 Product: Magnesium 4-(1,1-Dimethylethyl)Benzoate No suppilers available for the product. |
| Name | Magnesium 4-(1,1-Dimethylethyl)Benzoate |
|---|---|
| Synonyms | Benzoic Acid, 4-(1,1-Dimethylethyl)-, Magnesium Salt; Magnesium 4-(1,1-Dimethylethyl)Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26MgO4 |
| Molecular Weight | 378.75 |
| CAS Registry Number | 52509-83-8 |
| EINECS | 257-979-4 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1)C([O-])=O.C2=C(C(C)(C)C)C=CC(=C2)C([O-])=O.[Mg++] |
| InChI | 1S/2C11H14O2.Mg/c2*1-11(2,3)9-6-4-8(5-7-9)10(12)13;/h2*4-7H,1-3H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | OLQWRAPVOQGZQV-UHFFFAOYSA-L |
| Boiling point | 283.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Magnesium 4-(1,1-Dimethylethyl)Benzoate |