|
CAS#: 52578-56-0 Product: Diresorcyl sulphide No suppilers available for the product. |
| Name | Diresorcyl sulphide |
|---|---|
| Synonyms | 5-[(3,5-Dihydroxyphenyl)Thio]Benzene-1,3-Diol; 5-[(3,5-Dihydroxyphenyl)Thio]Resorcinol; Diresorcyl Sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27 |
| CAS Registry Number | 52578-56-0 |
| SMILES | C2=C(SC1=CC(=CC(=C1)O)O)C=C(O)C=C2O |
| InChI | 1S/C12H10O4S/c13-7-1-8(14)4-11(3-7)17-12-5-9(15)2-10(16)6-12/h1-6,13-16H |
| InChIKey | SQOKGOOYYFKAJJ-UHFFFAOYSA-N |
| Density | 1.638g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.825°C at 760 mmHg (Cal.) |
| Flash point | 255.788°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diresorcyl sulphide |