|
CAS#: 52618-68-5 Product: Tioperidone Hydrochloride No suppilers available for the product. |
| Name | Tioperidone Hydrochloride |
|---|---|
| Synonyms | 3-[4-[4-[2-(Propylthio)Phenyl]-1-Piperazinyl]Butyl]-1H-Quinazoline-2,4-Dione Hydrochloride; 3-[4-[4-[2-(Propylthio)Phenyl]Piperazin-1-Yl]Butyl]-1H-Quinazoline-2,4-Quinone Hydrochloride; Tioperidone Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C25H33ClN4O2S |
| Molecular Weight | 489.07 |
| CAS Registry Number | 52618-68-5 |
| SMILES | [H+].C4=C(N1CCN(CC1)CCCCN3C(=O)C2=CC=CC=C2NC3=O)C(=CC=C4)SCCC.[Cl-] |
| InChI | 1S/C25H32N4O2S.ClH/c1-2-19-32-23-12-6-5-11-22(23)28-17-15-27(16-18-28)13-7-8-14-29-24(30)20-9-3-4-10-21(20)26-25(29)31;/h3-6,9-12H,2,7-8,13-19H2,1H3,(H,26,31);1H |
| InChIKey | OWCJBBJRJRGZOJ-UHFFFAOYSA-N |
| Boiling point | 638.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 340.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tioperidone Hydrochloride |