|
CAS#: 52636-59-6 Product: 10-Bromonaphth[2,3-c]Acridine-5,8,14(13H)-Trione No suppilers available for the product. |
| Name | 10-Bromonaphth[2,3-c]Acridine-5,8,14(13H)-Trione |
|---|---|
| Synonyms | Naphth(2,3-C)Acridine-5,8,14(13H)-Trione, 10-Bromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H10BrNO3 |
| Molecular Weight | 404.22 |
| CAS Registry Number | 52636-59-6 |
| EINECS | 258-059-5 |
| SMILES | C2=C5C(=C1NC3=C(C(C1=C2)=O)C=C(C=C3)Br)C(C4=CC=CC=C4C5=O)=O |
| InChI | 1S/C21H10BrNO3/c22-10-5-8-16-15(9-10)20(25)14-7-6-13-17(18(14)23-16)21(26)12-4-2-1-3-11(12)19(13)24/h1-9H,(H,23,25) |
| InChIKey | PSDLWHWJRYDFNZ-UHFFFAOYSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.443°C at 760 mmHg (Cal.) |
| Flash point | 339.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Bromonaphth[2,3-c]Acridine-5,8,14(13H)-Trione |