Online Database of Chemicals from Around the World
|
CAS#: 5267-27-6 Product: 5-Methyl-2,4-Dinitrobenzenamine No suppilers available for the product. |
| Name | 5-Methyl-2,4-Dinitrobenzenamine |
|---|---|
| Synonyms | 5-Methyl-2,4-Dinitro-Aniline; (5-Methyl-2,4-Dinitro-Phenyl)Amine; 5-Amino-2,4-Dinitrotoluene |
| Molecular Structure |  |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.15 |
| CAS Registry Number | 5267-27-6 |
| SMILES | C1=C(N)C(=CC(=C1C)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C7H7N3O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,8H2,1H3 |
| InChIKey | XXEHKQSJODTTDH-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.292°C at 760 mmHg (Cal.) |
| Flash point | 202.542°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2,4-Dinitrobenzenamine |