Online Database of Chemicals from Around the World
| Name | 4-[(2-Chloro-4-Nitrophenyl)Azo]Aniline |
|---|---|
| Synonyms | 4-(2-Chloro-4-Nitro-Phenyl)Azoaniline; 4-(2-Chloro-4-Nitrophenyl)Azoaniline; [4-(2-Chloro-4-Nitro-Phenyl)Azophenyl]Amine |
| Molecular Structure | ![CAS#: 52735-98-5, 4-[(2-Chloro-4-Nitrophenyl)Azo]Aniline](/moreStructures/52735-98-5.gif) |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 |
| CAS Registry Number | 52735-98-5 |
| EINECS | 258-143-1 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1Cl)N=NC2=CC=C(N)C=C2 |
| InChI | 1S/C12H9ClN4O2/c13-11-7-10(17(18)19)5-6-12(11)16-15-9-3-1-8(14)2-4-9/h1-7H,14H2 |
| InChIKey | MAAZBPYSPLJNLQ-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.326°C at 760 mmHg (Cal.) |
| Flash point | 247.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(2-Chloro-4-Nitrophenyl)Azo]Aniline |
