|
CAS#: 52779-83-6 Product: [4-(1-Bromoethyl)Phenyl]-2-Thienyl Ketone No suppilers available for the product. |
| Name | [4-(1-Bromoethyl)Phenyl]-2-Thienyl Ketone |
|---|---|
| Synonyms | [4-(1-Bromoethyl)Phenyl]-(2-Thienyl)Methanone; [4-(1-Bromoethyl)Phenyl]-Thiophen-2-Yl-Methanone; (4-(1-Bromoethyl)Phenyl)-2-Thienyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11BrOS |
| Molecular Weight | 295.19 |
| CAS Registry Number | 52779-83-6 |
| EINECS | 258-171-4 |
| SMILES | C2=C(C(C1=CC=C(C=C1)C(Br)C)=O)SC=C2 |
| InChI | 1S/C13H11BrOS/c1-9(14)10-4-6-11(7-5-10)13(15)12-3-2-8-16-12/h2-9H,1H3 |
| InChIKey | GTJYMGWDCMZGCW-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.679°C at 760 mmHg (Cal.) |
| Flash point | 188.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(1-Bromoethyl)Phenyl]-2-Thienyl Ketone |