|
CAS#: 52821-19-9 Product: 6-Bromo-5-Nitro-1H,3H-Benzo[de]Isochromene-1,3-Dione No suppilers available for the product. |
| Name | 6-Bromo-5-Nitro-1H,3H-Benzo[de]Isochromene-1,3-Dione |
|---|---|
| Synonyms | 4-BROMO-3-NITRO-1,8-NAPHTHALICANHYDRIDE; 6-Bromo-5-nitro-1H,3H-benzo[de]isochromene-1,3-dione #; Naphthalic-1,8-anhydride, 4-bromo-3-nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4BrNO5 |
| Molecular Weight | 322.07 |
| CAS Registry Number | 52821-19-9 |
| SMILES | [O-][N+](=O)c2c(Br)c1cccc3c1c(c2)C(=O)OC3=O |
| InChI | 1S/C12H4BrNO5/c13-10-5-2-1-3-6-9(5)7(4-8(10)14(17)18)12(16)19-11(6)15/h1-4H |
| InChIKey | BCPUJMYCXASRIS-UHFFFAOYSA-N |
| Density | 1.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.561°C at 760 mmHg (Cal.) |
| Flash point | 263.788°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-5-Nitro-1H,3H-Benzo[de]Isochromene-1,3-Dione |