|
CAS#: 5284-73-1 Product: Methyl 3-Methylbenzothiazolium Sulphate No suppilers available for the product. |
| Name | Methyl 3-Methylbenzothiazolium Sulphate |
|---|---|
| Synonyms | Benzothiazolium, 3-Methyl-, Methyl Sulfate; Methyl 3-Methylbenzothiazolium Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.31 |
| CAS Registry Number | 5284-73-1 |
| EINECS | 226-115-8 |
| SMILES | C1=[N+](C2=C(S1)C=CC=C2)C.CO[S]([O-])(=O)=O |
| InChI | 1S/C8H8NS.CH4O4S/c1-9-6-10-8-5-3-2-4-7(8)9;1-5-6(2,3)4/h2-6H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | QPTHLIIYYVUGSV-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Methylbenzothiazolium Sulphate |