|
CAS#: 52884-84-1 Product: Carbonic Acid Allyl 3beta-Cholesteryl Ester No suppilers available for the product. |
| Name | Carbonic Acid Allyl 3beta-Cholesteryl Ester |
|---|---|
| Synonyms | Allyl [(3S,8S,9S,10R,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Carbonate; Carbonic Acid Allyl [(3S,8S,9S,10R,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Ester; Cholest-5-En-3-Ol (3Beta)-, 2-Propenyl Carbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.73 |
| CAS Registry Number | 52884-84-1 |
| SMILES | [C@H]34[C@H]1[C@@H]([C@@]2(C(=CC1)C[C@@H](OC(OCC=C)=O)CC2)C)CC[C@@]3([C@H](CC4)[C@@H](CCCC(C)C)C)C |
| InChI | 1S/C31H50O3/c1-7-19-33-29(32)34-24-15-17-30(5)23(20-24)11-12-25-27-14-13-26(22(4)10-8-9-21(2)3)31(27,6)18-16-28(25)30/h7,11,21-22,24-28H,1,8-10,12-20H2,2-6H3/t22-,24+,25+,26-,27+,28+,30+,31-/m1/s1 |
| InChIKey | MULONECVTATJGA-GTPODGLVSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.382°C at 760 mmHg (Cal.) |
| Flash point | 141.397°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbonic Acid Allyl 3beta-Cholesteryl Ester |