Online Database of Chemicals from Around the World
|
CAS#: 52934-78-8 Product: Hippomannin A No suppilers available for the product. |
| Name | Hippomannin A |
|---|---|
| Synonyms | Hippomannin A |
| Molecular Structure |  |
| Molecular Formula | C27H22O18 |
| Molecular Weight | 634.46 |
| CAS Registry Number | 52934-78-8 |
| SMILES | C1=C(O)C(=C(O)C2=C1C(OC(C(O)COC(=O)C3=CC(=C(O)C(=C23)O)O)C(O)C(OC(=O)C4=CC(=C(O)C(=C4)O)O)C=O)=O)O |
| InChI | 1S/C27H22O18/c28-5-15(44-25(40)7-1-10(29)18(34)11(30)2-7)21(37)24-14(33)6-43-26(41)8-3-12(31)19(35)22(38)16(8)17-9(27(42)45-24)4-13(32)20(36)23(17)39/h1-5,14-15,21,24,29-39H,6H2 |
| InChIKey | KIWFFZKABNOAQU-UHFFFAOYSA-N |
| Density | 1.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 1274.054°C at 760 mmHg (Cal.) |
| Flash point | 415.576°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hippomannin A |