|
CAS#: 52995-00-3 Product: 3-Phenoxy-1,2-Benzenediol No suppilers available for the product. |
| Name | 3-Phenoxy-1,2-Benzenediol |
|---|---|
| Synonyms | 3-(Phenoxy)Pyrocatechol; 1,2-Benzenediol, 3-Phenoxy-; 3-Phenoxypyrocatechol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 52995-00-3 |
| SMILES | C1=CC=C(O)C(=C1OC2=CC=CC=C2)O |
| InChI | 1S/C12H10O3/c13-10-7-4-8-11(12(10)14)15-9-5-2-1-3-6-9/h1-8,13-14H |
| InChIKey | HLRZKIOOLGZAFC-UHFFFAOYSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.88°C at 760 mmHg (Cal.) |
| Flash point | 149.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenoxy-1,2-Benzenediol |