|
CAS#: 530-17-6 Product: 2-(1-Methylpropyl)-4,6-Dinitrophenol No suppilers available for the product. |
| Name | 2-(1-Methylpropyl)-4,6-Dinitrophenol |
|---|---|
| Synonyms | 2-Isobutyl-4,6-Dinitrophenol; 2-(2-Methylpropyl)-4,6-Dinitro-Phenol; 2-(2-Methylpropyl)-4,6-Dinitrophenol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 |
| CAS Registry Number | 530-17-6 |
| SMILES | C1=C(C=C([N+]([O-])=O)C(=C1CC(C)C)O)[N+]([O-])=O |
| InChI | 1S/C10H12N2O5/c1-6(2)3-7-4-8(11(14)15)5-9(10(7)13)12(16)17/h4-6,13H,3H2,1-2H3 |
| InChIKey | ZCUZYXAJTZQRHO-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.572°C at 760 mmHg (Cal.) |
| Flash point | 153.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Methylpropyl)-4,6-Dinitrophenol |