|
CAS#: 53046-85-8 Product: Tetramethyl Propane-1,2,2,3-Tetracarboxylate No suppilers available for the product. |
| Name | Tetramethyl Propane-1,2,2,3-Tetracarboxylate |
|---|---|
| Synonyms | Tetramethyl Propane-1,2,2,3-Tetracarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 |
| CAS Registry Number | 53046-85-8 |
| EINECS | 258-321-9 |
| SMILES | C(C(C(=O)OC)(C(=O)OC)CC(=O)OC)C(=O)OC |
| InChI | 1S/C11H16O8/c1-16-7(12)5-11(9(14)18-3,10(15)19-4)6-8(13)17-2/h5-6H2,1-4H3 |
| InChIKey | RFHYWFVQMMSWHX-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.381°C at 760 mmHg (Cal.) |
| Flash point | 144.49°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetramethyl Propane-1,2,2,3-Tetracarboxylate |