|
CAS#: 53097-60-2 Product: Pentabromo(2-Bromoethyl)Benzene No suppilers available for the product. |
| Name | Pentabromo(2-Bromoethyl)Benzene |
|---|---|
| Synonyms | Pentabromo(2-Bromoethyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Br6 |
| Molecular Weight | 579.54 |
| CAS Registry Number | 53097-60-2 |
| EINECS | 258-360-1 |
| SMILES | C(C1=C(C(=C(C(=C1Br)Br)Br)Br)Br)CBr |
| InChI | 1S/C8H4Br6/c9-2-1-3-4(10)6(12)8(14)7(13)5(3)11/h1-2H2 |
| InChIKey | VCKGAEKPOCKYJV-UHFFFAOYSA-N |
| Density | 2.679g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.295°C at 760 mmHg (Cal.) |
| Flash point | 225.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentabromo(2-Bromoethyl)Benzene |