|
CAS#: 53130-86-2 Product: 6-Amino-1H-Purine-8-Methanol Acetate (Ester) No suppilers available for the product. |
| Name | 6-Amino-1H-Purine-8-Methanol Acetate (Ester) |
|---|---|
| Synonyms | Acetic Acid (6-Amino-7H-Purin-8-Yl)Methyl Ester; (6-Amino-7H-Purin-8-Yl)Methyl Ethanoate; (6-Amino-9H-Purin-8-Yl)Methyl Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 53130-86-2 |
| SMILES | C2=NC(=C1[NH]C(=NC1=N2)COC(=O)C)N |
| InChI | 1S/C8H9N5O2/c1-4(14)15-2-5-12-6-7(9)10-3-11-8(6)13-5/h3H,2H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | ULXCKGMHUKQDJL-UHFFFAOYSA-N |
| Density | 1.516g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.367°C at 760 mmHg (Cal.) |
| Flash point | 270.927°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-1H-Purine-8-Methanol Acetate (Ester) |