|
CAS#: 53198-46-2 Product: N-Nitroso(Acetoxybenzyl)Methylamine No suppilers available for the product. |
| Name | N-Nitroso(Acetoxybenzyl)Methylamine |
|---|---|
| Synonyms | [(Methyl-Nitroso-Amino)-Phenyl-Methyl] Acetate; Acetic Acid [(Methyl-Nitrosoamino)-Phenylmethyl] Ester; Acetic Acid [(Methyl-Nitroso-Amino)-Phenyl-Methyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 53198-46-2 |
| SMILES | C1=C(C(OC(=O)C)N(C)N=O)C=CC=C1 |
| InChI | 1S/C10H12N2O3/c1-8(13)15-10(12(2)11-14)9-6-4-3-5-7-9/h3-7,10H,1-2H3 |
| InChIKey | SKQBMDZSCODYSQ-UHFFFAOYSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.212°C at 760 mmHg (Cal.) |
| Flash point | 171.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Nitroso(Acetoxybenzyl)Methylamine |