|
CAS#: 53207-52-6 Product: 2,3-Dihydro-1,3,3-Trimethylquinolin-4(1H)-One No suppilers available for the product. |
| Name | 2,3-Dihydro-1,3,3-Trimethylquinolin-4(1H)-One |
|---|---|
| Synonyms | 1,2,3,4-Tetrahydro-1,3,3-Trimethyl-4-Quinolinone; 4(1H)-Quinolinone, 2,3-Dihydro-1,3,3-Trimethyl- (9Ci); 4-Quinolinone, 1,2,3,4-Tetrahydro-1,3,3-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 |
| CAS Registry Number | 53207-52-6 |
| SMILES | C1=CC=CC2=C1C(C(CN2C)(C)C)=O |
| InChI | 1S/C12H15NO/c1-12(2)8-13(3)10-7-5-4-6-9(10)11(12)14/h4-7H,8H2,1-3H3 |
| InChIKey | CDRRBVFIMBIPIT-UHFFFAOYSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.574°C at 760 mmHg (Cal.) |
| Flash point | 106.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-1,3,3-Trimethylquinolin-4(1H)-One |