|
CAS#: 53254-94-7 Product: 3,8-Dihydroxy-1-methyl-9,10-Anthracenedione No suppilers available for the product. |
| Name | 3,8-Dihydroxy-1-methyl-9,10-Anthracenedione |
|---|---|
| Synonyms | 3,8-Dihydroxy-1-Methyl-Anthracene-9,10-Dione; 3,8-Dihydroxy-1-Methyl-9,10-Anthraquinone; 9,10-Anthracenedione, 3,8-Dihydroxy-1-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 53254-94-7 |
| SMILES | C1=C2C(=C(C=C1O)C)C(C3=C(C2=O)C=CC=C3O)=O |
| InChI | 1S/C15H10O4/c1-7-5-8(16)6-10-12(7)15(19)13-9(14(10)18)3-2-4-11(13)17/h2-6,16-17H,1H3 |
| InChIKey | BXWJOXJOMFDQNV-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.373°C at 760 mmHg (Cal.) |
| Flash point | 259.637°C (Cal.) |
| (1) | Bringmann et al.. Different polyketide folding modes converge to an identical molecular architecture, Nature Chemical Biology, 2006 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,8-Dihydroxy-1-methyl-9,10-Anthracenedione |