|
CAS#: 5328-04-1 Product: Copper3-Phenylsalicylate No suppilers available for the product. |
| Name | Copper3-Phenylsalicylate |
|---|---|
| Synonyms | Copper 2-Oxido-3-Phenyl-Benzoate; Cupric 2-Oxido-3-Phenyl-Benzoate; Caswell No. 251 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8CuO3 |
| Molecular Weight | 275.75 |
| CAS Registry Number | 5328-04-1 |
| SMILES | [Cu++].C1=CC=C(C(=C1C2=CC=CC=C2)[O-])C([O-])=O |
| InChI | 1S/C13H10O3.Cu/c14-12-10(9-5-2-1-3-6-9)7-4-8-11(12)13(15)16;/h1-8,14H,(H,15,16);/q;+2/p-2 |
| InChIKey | ZKEGKBWNYMVWCA-UHFFFAOYSA-L |
| Boiling point | 393.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Copper3-Phenylsalicylate |