|
CAS#: 53300-36-0 Product: 6-Hydroxy-Naphtho[1,2-c]Furan-1,3-Dione No suppilers available for the product. |
| Name | 6-Hydroxy-Naphtho[1,2-c]Furan-1,3-Dione |
|---|---|
| Synonyms | 6-Hydroxybenzo[E]Isobenzofuran-1,3-Dione; 6-Hydroxybenzo[E]Isobenzofuran-1,3-Quinone; Nsc 148908 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6O4 |
| Molecular Weight | 214.18 |
| CAS Registry Number | 53300-36-0 |
| SMILES | C1=CC(=C2C(=C1)C3=C(C=C2)C(OC3=O)=O)O |
| InChI | 1S/C12H6O4/c13-9-3-1-2-7-6(9)4-5-8-10(7)12(15)16-11(8)14/h1-5,13H |
| InChIKey | GXTHFPLTRVFHTD-UHFFFAOYSA-N |
| Density | 1.585g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.057°C at 760 mmHg (Cal.) |
| Flash point | 198.507°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Hydroxy-Naphtho[1,2-c]Furan-1,3-Dione |