|
CAS#: 5333-82-4 Product: alpha-(Trichloromethyl)-4-Chlorobenzenemethanol No suppilers available for the product. |
| Name | alpha-(Trichloromethyl)-4-Chlorobenzenemethanol |
|---|---|
| Synonyms | Benzenemethanol, 4-Chloro-.Alpha.-(Trichloromethyl)-; Benzyl Alcohol, P-Chloro-.Alpha.-(Trichloromethyl)-; Nsc2349 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl4O |
| Molecular Weight | 259.95 |
| CAS Registry Number | 5333-82-4 |
| SMILES | C1=CC(=CC=C1C(C(Cl)(Cl)Cl)O)Cl |
| InChI | 1S/C8H6Cl4O/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4,7,13H |
| InChIKey | LQAPSMWXDFJNGU-UHFFFAOYSA-N |
| Density | 1.56g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.737°C at 760 mmHg (Cal.) |
| Flash point | 151.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Trichloromethyl)-4-Chlorobenzenemethanol |