|
CAS#: 5337-60-0 Product: Tris(2-Chlorophenyl) Borate No suppilers available for the product. |
| Name | Tris(2-Chlorophenyl) Borate |
|---|---|
| Synonyms | Nsc 808; Tri-O-Chlorophenyl Borate; Tris(2-Chlorophenyl) Borate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12BCl3O3 |
| Molecular Weight | 393.46 |
| CAS Registry Number | 5337-60-0 |
| EINECS | 226-263-3 |
| SMILES | C3=C(OB(OC1=CC=CC=C1Cl)OC2=CC=CC=C2Cl)C(=CC=C3)Cl |
| InChI | 1S/C18H12BCl3O3/c20-13-7-1-4-10-16(13)23-19(24-17-11-5-2-8-14(17)21)25-18-12-6-3-9-15(18)22/h1-12H |
| InChIKey | JNEZJAAADKQBBD-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.275°C at 760 mmHg (Cal.) |
| Flash point | 210.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(2-Chlorophenyl) Borate |