|
CAS#: 53378-52-2 Product: Sodium O,O-Diisobutyl Phosphorothioate No suppilers available for the product. |
| Name | Sodium O,O-Diisobutyl Phosphorothioate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H18NaO3PS |
| Molecular Weight | 248.26 |
| CAS Registry Number | 53378-52-2 |
| SMILES | [Na+].[O-]P(=S)(OCC(C)C)OCC(C)C |
| InChI | 1S/C8H19O3PS.Na/c1-7(2)5-10-12(9,13)11-6-8(3)4;/h7-8H,5-6H2,1-4H3,(H,9,13);/q;+1/p-1 |
| InChIKey | VVTVDXPOGQYVFX-UHFFFAOYSA-M |
| Boiling point | 275.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 120.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium O,O-Diisobutyl Phosphorothioate |