|
CAS#: 53400-68-3 Product: Tiquinamide No suppilers available for the product. |
| Name | Tiquinamide |
|---|---|
| Synonyms | Wy-24,081 Hcl; 5,6,7,8-Tetrahydro-3-Methylthio-8-Quinolinecarboxamide Monohydrochloride; 8-Quinolinecarbothioamide, 5,6,7,8-Tetrahydro-3-Methyl-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.77 |
| CAS Registry Number | 53400-68-3 |
| SMILES | [H+].C1=C(C=NC2=C1CCCC2C(=S)N)C.[Cl-] |
| InChI | 1S/C11H14N2S.ClH/c1-7-5-8-3-2-4-9(11(12)14)10(8)13-6-7;/h5-6,9H,2-4H2,1H3,(H2,12,14);1H |
| InChIKey | KYIUXKQDIWZDEF-UHFFFAOYSA-N |
| Boiling point | 383.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 185.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tiquinamide |