|
CAS#: 5341-14-0 Product: Tris(4-Biphenyl)-Methanol No suppilers available for the product. |
| Name | Tris(4-Biphenyl)-Methanol |
|---|---|
| Synonyms | Nsc2053; Tris(4-Biphenylyl)Methanol; Nci60_001727 |
| Molecular Structure | ![]() |
| Molecular Formula | C37H28O |
| Molecular Weight | 488.63 |
| CAS Registry Number | 5341-14-0 |
| SMILES | C5=C(C(C2=CC=C(C1=CC=CC=C1)C=C2)(C3=CC=C(C=C3)C4=CC=CC=C4)O)C=CC(=C5)C6=CC=CC=C6 |
| InChI | 1S/C37H28O/c38-37(34-22-16-31(17-23-34)28-10-4-1-5-11-28,35-24-18-32(19-25-35)29-12-6-2-7-13-29)36-26-20-33(21-27-36)30-14-8-3-9-15-30/h1-27,38H |
| InChIKey | FURWFDHTIUIMDC-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 671.049°C at 760 mmHg (Cal.) |
| Flash point | 214.577°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tris(4-Biphenyl)-Methanol |