| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N-Benzylidene-3-Nitroaniline |
|---|---|
| Synonyms | N-(3-Nitrophenyl)-1-Phenyl-Methanimine; Benzylidene-(3-Nitrophenyl)Amine; Benzenamine, 3-Nitro-N-(Phenylmethylene)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 5341-44-6 |
| SMILES | C2=C(N=CC1=CC=CC=C1)C=CC=C2[N+]([O-])=O |
| InChI | 1S/C13H10N2O2/c16-15(17)13-8-4-7-12(9-13)14-10-11-5-2-1-3-6-11/h1-10H |
| InChIKey | HFGFPUPROHHWFT-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.698°C at 760 mmHg (Cal.) |
| Flash point | 187.668°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Minkin V I, Bren V A. Basicity and structure of azomethines and their structural analogs, Organic Reactivity, 1967, 4, 45-51 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Benzylidene-3-Nitroaniline |