|
CAS#: 53446-63-2 Product: 2-Isopropylindan-1-One No suppilers available for the product. |
| Name | 2-Isopropylindan-1-One |
|---|---|
| Synonyms | 2-Isopropylindan-1-One; 2-Isopropyl-1-Indanone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 |
| CAS Registry Number | 53446-63-2 |
| EINECS | 258-558-8 |
| SMILES | C1=CC2=C(C=C1)CC(C2=O)C(C)C |
| InChI | 1S/C12H14O/c1-8(2)11-7-9-5-3-4-6-10(9)12(11)13/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | WBCAKNRIXCUKPZ-UHFFFAOYSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.735°C at 760 mmHg (Cal.) |
| Flash point | 107.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropylindan-1-One |