Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Calcium L-Arabonate |
|---|---|
| Synonyms | Calcium 2,3,4,5-Tetrahydroxyvaleric Acid; Calcium Di-L-Arabinonate |
| Molecular Structure |  |
| Molecular Formula | C5H10CaO6 |
| Molecular Weight | 206.21 |
| CAS Registry Number | 5346-83-8 |
| EINECS | 226-302-4 |
| SMILES | C(O)C(O)C(O)C(O)C(O)=O.[Ca++] |
| InChI | 1S/C5H10O6.Ca/c6-1-2(7)3(8)4(9)5(10)11;/h2-4,6-9H,1H2,(H,10,11);/q;+2 |
| InChIKey | BEGCFTRUKPSGFM-UHFFFAOYSA-N |
| Boiling point | 584°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 321°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Calcium L-Arabonate |