|
CAS#: 53460-81-4 Product: 4-Chloromethyl-2-(2-Nitrophenyl)-1,3-Dioxolane No suppilers available for the product. |
| Name | 4-Chloromethyl-2-(2-Nitrophenyl)-1,3-Dioxolane |
|---|---|
| Synonyms | 1,3-Dioxolane, 4-(Chloromethyl)-2-(O-Nitrophenyl)-; 4-(Chloromethyl)-2-(O-Nitrophenyl)-1,3-Dioxolane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 |
| CAS Registry Number | 53460-81-4 |
| SMILES | C1=CC=CC(=C1C2OC(CO2)CCl)[N+]([O-])=O |
| InChI | 1S/C10H10ClNO4/c11-5-7-6-15-10(16-7)8-3-1-2-4-9(8)12(13)14/h1-4,7,10H,5-6H2 |
| InChIKey | LQLVIUVTQZTSAJ-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.386°C at 760 mmHg (Cal.) |
| Flash point | 173.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloromethyl-2-(2-Nitrophenyl)-1,3-Dioxolane |