|
CAS#: 53477-27-3 Product: N,N-Dimethyl-4-[[4-(Methylamino)Phenyl]Methyl]Benzenamine No suppilers available for the product. |
| Name | N,N-Dimethyl-4-[[4-(Methylamino)Phenyl]Methyl]Benzenamine |
|---|---|
| Synonyms | Dimethyl-[4-(4-Methylaminobenzyl)Phenyl]Amine; Benzenamine, N,N-Dimethyl-4-((4-(Methylamino)Phenyl)Methyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 |
| CAS Registry Number | 53477-27-3 |
| SMILES | C1=C(C=CC(=C1)CC2=CC=C(C=C2)N(C)C)NC |
| InChI | 1S/C16H20N2/c1-17-15-8-4-13(5-9-15)12-14-6-10-16(11-7-14)18(2)3/h4-11,17H,12H2,1-3H3 |
| InChIKey | JMULIAGRGJQNJJ-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.961°C at 760 mmHg (Cal.) |
| Flash point | 161.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-[[4-(Methylamino)Phenyl]Methyl]Benzenamine |