|
CAS#: 53510-49-9 Product: N,N,N',N'-Tetramethyl-9H-Xanthene-3,6-Diamine No suppilers available for the product. |
| Name | N,N,N',N'-Tetramethyl-9H-Xanthene-3,6-Diamine |
|---|---|
| Synonyms | (6-Dimethylamino-9H-Xanthen-3-Yl)-Dimethyl-Amine; 9H-Xanthene-3,6-Diamine, N,N,N',N'-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 |
| CAS Registry Number | 53510-49-9 |
| SMILES | C2=C1OC3=C(CC1=CC=C2N(C)C)C=CC(=C3)N(C)C |
| InChI | 1S/C17H20N2O/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | GQXCVTPPQVJMIF-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.199°C at 760 mmHg (Cal.) |
| Flash point | 131.93°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,N',N'-Tetramethyl-9H-Xanthene-3,6-Diamine |