|
CAS#: 53542-48-6 Product: 9-(3-Chloropropyl)-6-Fluoro-2-(Trifluoromethyl)-9H-Thioxanthene No suppilers available for the product. |
| Name | 9-(3-Chloropropyl)-6-Fluoro-2-(Trifluoromethyl)-9H-Thioxanthene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H13ClF4S |
| Molecular Weight | 360.80 |
| CAS Registry Number | 53542-48-6 |
| EINECS | 258-620-4 |
| SMILES | C1=C(C(F)(F)F)C=CC3=C1C(C2=CC=C(C=C2S3)F)CCCCl |
| InChI | 1S/C17H13ClF4S/c18-7-1-2-12-13-5-4-11(19)9-16(13)23-15-6-3-10(8-14(12)15)17(20,21)22/h3-6,8-9,12H,1-2,7H2 |
| InChIKey | BRWGHNMSDBLZLJ-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.795°C at 760 mmHg (Cal.) |
| Flash point | 181.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(3-Chloropropyl)-6-Fluoro-2-(Trifluoromethyl)-9H-Thioxanthene |