|
CAS#: 5359-92-2 Product: 11,18-18,20-Diepoxypregnan-3-Ol No suppilers available for the product. |
| Name | 11,18-18,20-Diepoxypregnan-3-Ol |
|---|---|
| Synonyms | 11,18-18,20-Diepoxypregnan-3-Ol; Kelly M1 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 |
| CAS Registry Number | 5359-92-2 |
| SMILES | [C@H]1(CC[C@]4([C@@H](C1)CC[C@H]5[C@@H]2CC[C@@H]3[C@H](C)OC6C23C[C@H]([C@H]45)O6)C)O |
| InChI | 1S/C21H32O3/c1-11-15-5-6-16-14-4-3-12-9-13(22)7-8-20(12,2)18(14)17-10-21(15,16)19(23-11)24-17/h11-19,22H,3-10H2,1-2H3/t11-,12+,13+,14-,15+,16-,17+,18+,19?,20-,21?/m0/s1 |
| InChIKey | PDRIWHNWBPWLNX-YHAXPTRZSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.371°C at 760 mmHg (Cal.) |
| Flash point | 229.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,18-18,20-Diepoxypregnan-3-Ol |