| Enamine Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | (R)-1,2,3,4-Tetrahydro-1-Methyl-6,7-Isoquinolinediol |
|---|---|
| Synonyms | (+/-) Salsolinol; 525-72-4 (Free Base); 6,7-Isoquinolinediol, 1,2,3,4-Tetrahydro-1-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| CAS Registry Number | 53622-83-6 |
| SMILES | C1=C(O)C(=CC2=C1C(NCC2)C)O |
| InChI | 1S/C10H13NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h4-6,11-13H,2-3H2,1H3 |
| InChIKey | IBRKLUSXDYATLG-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Melting point | 186-187°C (Expl.) |
| Boiling point | 362.637°C at 760 mmHg (Cal.) |
| Flash point | 175.387°C (Cal.) |
| (1) | Wen Zhang, Yunfeng Xie, Jing Gu, Shiyun Ai, Jian Wang, Katsunobu Yamamoto and Litong Jin. Liquid chromatography with amperometric detection at a nano crystalline Ce-doped lead dioxide film modified electrode for determination of (R)-Salsolinol, (R)-N-methylsalsolinol and monoamine neurotra nsmitters in Parkinsonian patients' cerebrospinal fluid, Analyst, 2004, 129, 229. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (R)-1,2,3,4-Tetrahydro-1-Methyl-6,7-Isoquinolinediol |