|
CAS#: 53679-54-2 Product: Toluene Diisocyanate, Hydrazine Polymer No suppilers available for the product. |
| Name | Toluene Diisocyanate, Hydrazine Polymer |
|---|---|
| Synonyms | 1,3-Diisocyanato-2-Methyl-Benzene; Hydrazine; Hydrazine, Polymer With 1,3-Diisocyanatomethylbenzene; Toluene Diisocyanate, Hydrazine Polymer |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 |
| CAS Registry Number | 53679-54-2 |
| SMILES | O=C=NC1=C(C(=CC=C1)N=C=O)C.NN |
| InChI | 1S/C9H6N2O2.H4N2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13;1-2/h2-4H,1H3;1-2H2 |
| InChIKey | LOBRKHBTXXVLOH-UHFFFAOYSA-N |
| Boiling point | 248.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Toluene Diisocyanate, Hydrazine Polymer |