|
CAS#: 5372-11-2 Product: 5-(2-Chloroethoxy)-3-Methyl-1-Phenyl-1H-Pyrazole No suppilers available for the product. |
| Name | 5-(2-Chloroethoxy)-3-Methyl-1-Phenyl-1H-Pyrazole |
|---|---|
| Synonyms | 5-(2-Chloroethoxy)-3-Methyl-1-Phenylpyrazole; Brn 0884571; P-312 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 |
| CAS Registry Number | 5372-11-2 |
| SMILES | C1=C([N](N=C1C)C2=CC=CC=C2)OCCCl |
| InChI | 1S/C12H13ClN2O/c1-10-9-12(16-8-7-13)15(14-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | XKNAUWCCPDILRI-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.775°C at 760 mmHg (Cal.) |
| Flash point | 173.201°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-Chloroethoxy)-3-Methyl-1-Phenyl-1H-Pyrazole |