|
CAS#: 53727-39-2 Product: 5-(Dimethylamino)-1-Methyl-3-Phenyluracil No suppilers available for the product. |
| Name | 5-(Dimethylamino)-1-Methyl-3-Phenyluracil |
|---|---|
| Synonyms | 5-Dimethylamino-1-Methyl-3-Phenyl-Pyrimidine-2,4-Dione; 5-Dimethylamino-1-Methyl-3-Phenyl-Pyrimidine-2,4-Quinone; Brn 0666412 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 |
| CAS Registry Number | 53727-39-2 |
| SMILES | C1=CC=CC=C1N2C(N(C=C(C2=O)N(C)C)C)=O |
| InChI | 1S/C13H15N3O2/c1-14(2)11-9-15(3)13(18)16(12(11)17)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | HGTNFDRANJNWME-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.247°C at 760 mmHg (Cal.) |
| Flash point | 146.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Dimethylamino)-1-Methyl-3-Phenyluracil |