|
CAS#: 53757-29-2 Product: 2-Methyl-4-(5-Nitro-2-Furyl)Thiazole No suppilers available for the product. |
| Name | 2-Methyl-4-(5-Nitro-2-Furyl)Thiazole |
|---|---|
| Synonyms | 2-Methyl-4-(5-Nitro-2-Furyl)Thiazole; 2-Methyl-4-(5-Nitro-2-Furanyl)Thiazole; Brn 1077089 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 |
| CAS Registry Number | 53757-29-2 |
| SMILES | C1=C(OC(=C1)C2=CSC(=N2)C)[N+]([O-])=O |
| InChI | 1S/C8H6N2O3S/c1-5-9-6(4-14-5)7-2-3-8(13-7)10(11)12/h2-4H,1H3 |
| InChIKey | BGWAGUMLJYQZDM-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.76°C at 760 mmHg (Cal.) |
| Flash point | 164.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(5-Nitro-2-Furyl)Thiazole |