|
CAS#: 537678-14-1 Product: 2-(4-Methylphenyl)-3-[(4-Phenoxyphenyl)Sulfonyl]-1,3-Thiazolidine No suppilers available for the product. |
| Name | 2-(4-Methylphenyl)-3-[(4-Phenoxyphenyl)Sulfonyl]-1,3-Thiazolidine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.54 |
| CAS Registry Number | 537678-14-1 |
| SMILES | Cc1ccc(cc1)C2N(CCS2)S(=O)(=O)c3ccc(cc3)Oc4ccccc4 |
| InChI | 1S/C22H21NO3S2/c1-17-7-9-18(10-8-17)22-23(15-16-27-22)28(24,25)21-13-11-20(12-14-21)26-19-5-3-2-4-6-19/h2-14,22H,15-16H2,1H3 |
| InChIKey | CTNHEIHPTLMREY-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.566°C at 760 mmHg (Cal.) |
| Flash point | 305.52°C (Cal.) |
| Refractive index | 1.645 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methylphenyl)-3-[(4-Phenoxyphenyl)Sulfonyl]-1,3-Thiazolidine |