|
CAS#: 53816-99-2 Product: 4,6-Bis(1-Phenylethyl)-m-Xylene No suppilers available for the product. |
| Name | 4,6-Bis(1-Phenylethyl)-m-Xylene |
|---|---|
| Synonyms | 4,6-Bis(1-Phenylethyl)-M-Xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 53816-99-2 |
| EINECS | 258-798-3 |
| SMILES | C1=C(C(=CC(=C1C(C2=CC=CC=C2)C)C)C)C(C3=CC=CC=C3)C |
| InChI | 1S/C24H26/c1-17-15-18(2)24(20(4)22-13-9-6-10-14-22)16-23(17)19(3)21-11-7-5-8-12-21/h5-16,19-20H,1-4H3 |
| InChIKey | MQXKSESRXIZXFR-UHFFFAOYSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.359°C at 760 mmHg (Cal.) |
| Flash point | 208.728°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Bis(1-Phenylethyl)-m-Xylene |