|
CAS#: 53823-71-5 Product: Potassium 1-O-(hydroxyphosphinato)-alpha-D-glucopyranose No suppilers available for the product. |
| Name | Potassium 1-O-(hydroxyphosphinato)-alpha-D-glucopyranose |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H12KO9P |
| Molecular Weight | 298.23 |
| CAS Registry Number | 53823-71-5 |
| EINECS | 258-812-8 |
| SMILES | [K+].[O-]P(=O)(O)O[C@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| InChI | 1S/C6H13O9P.K/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13;/h2-10H,1H2,(H2,11,12,13);/q;+1/p-1/t2-,3-,4+,5-,6-;/m1./s1 |
| InChIKey | ZNOUUYCUFMKMNZ-WYRLRVFGSA-M |
| Boiling point | 603°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 318.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 1-O-(hydroxyphosphinato)-alpha-D-glucopyranose |